C30H32F5N5O2 — CID 177333472
(12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-[[(1R)-1-phenylethyl]amino]-11-oxa-3,9,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-4-one (PubChem CID 177333472) has the molecular formula C30H32F5N5O2 and a molecular weight of 589.61 g/mol. Its IUPAC name is (12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-[[(1R)-1-phenylethyl]amino]-11-oxa-3,9,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-4-one.
| Compound Name | (12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-[[(1R)-1-phenylethyl]amino]-11-oxa-3,9,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-4-one |
|---|---|
| PubChem CID | 177333472 |
| Molecular Formula | C30H32F5N5O2 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-[[(1R)-1-phenylethyl]amino]-11-oxa-3,9,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-4-one |
| SMILES | Cc1c(F)c(N)cc(-c2nc3c(c(N[C@H](C)c4ccccc4)c2F)C(=O)NCC2CCC(C[C@H](C)O3)N2)c1C(F)(F)F |
| InChI | InChI=1S/C30H32F5N5O2/c1-14-11-18-9-10-19(39-18)13-37-28(41)22-27(38-16(3)17-7-5-4-6-8-17)25(32)26(40-29(22)42-14)20-12-21(36)24(31)15(2)23(20)30(33,34)35/h4-8,12,14,16,18-19,39H,9-11,13,36H2,1-3H3,(H,37,41)(H,38,40)/t14-,16+,18?,19?/m0/s1 |
| InChIKey | AYDDRWJALDLPNF-FIZCFOIVSA-N |
| XLogP | 6.13 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|