C28H37F5N6O3 — CID 177333491
6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-butan-2-yloxy-5-fluoro-4-(1,3-oxazol-2-ylmethylamino)pyridine-3-carbaldehyde;ethane;N-methyl-2-(methylideneamino)ethanamine (PubChem CID 177333491) has the molecular formula C28H37F5N6O3 and a molecular weight of 600.63 g/mol. Its IUPAC name is 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-butan-2-yloxy-5-fluoro-4-(1,3-oxazol-2-ylmethylamino)pyridine-3-carbaldehyde;ethane;N-methyl-2-(methylideneamino)ethanamine.
| Compound Name | 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-butan-2-yloxy-5-fluoro-4-(1,3-oxazol-2-ylmethylamino)pyridine-3-carbaldehyde;ethane;N-methyl-2-(methylideneamino)ethanamine |
|---|---|
| PubChem CID | 177333491 |
| Molecular Formula | C28H37F5N6O3 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-butan-2-yloxy-5-fluoro-4-(1,3-oxazol-2-ylmethylamino)pyridine-3-carbaldehyde;ethane;N-methyl-2-(methylideneamino)ethanamine |
| SMILES | C=NCCNC.CC.CCC(C)Oc1nc(-c2cc(N)c(F)c(C)c2C(F)(F)F)c(F)c(NCc2ncco2)c1C=O |
| InChI | InChI=1S/C22H21F5N4O3.C4H10N2.C2H6/c1-4-10(2)34-21-13(9-32)19(30-8-15-29-5-6-33-15)18(24)20(31-21)12-7-14(28)17(23)11(3)16(12)22(25,26)27;1-5-3-4-6-2;1-2/h5-7,9-10H,4,8,28H2,1-3H3,(H,30,31);6H,1,3-4H2,2H3;1-2H3 |
| InChIKey | UKUYKKXQVOXQNQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|