C13H9N3O2 — CID 177333537
4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-1(16),2,5(10),6,8,14-hexaen-11-one (PubChem CID 177333537) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-1(16),2,5(10),6,8,14-hexaen-11-one.
| Compound Name | 4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-1(16),2,5(10),6,8,14-hexaen-11-one |
|---|---|
| PubChem CID | 177333537 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-1(16),2,5(10),6,8,14-hexaen-11-one |
| SMILES | O=C1c2cccnc2OC=C2c3ccc([nH]3)CN12 |
| InChI | InChI=1S/C13H9N3O2/c17-13-9-2-1-5-14-12(9)18-7-11-10-4-3-8(15-10)6-16(11)13/h1-5,7,15H,6H2 |
| InChIKey | STJCIXZCNLAOJR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |