C25H23F5N6O3 — CID 177333569
(12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-(1,2-oxazol-5-ylmethylamino)-11-oxa-3,9,15-triazatricyclo[12.1.1.05,10]hexadeca-1(16),5,7,9-tetraen-4-one (PubChem CID 177333569) has the molecular formula C25H23F5N6O3 and a molecular weight of 550.49 g/mol. Its IUPAC name is (12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-(1,2-oxazol-5-ylmethylamino)-11-oxa-3,9,15-triazatricyclo[12.1.1.05,10]hexadeca-1(16),5,7,9-tetraen-4-one.
| Compound Name | (12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-(1,2-oxazol-5-ylmethylamino)-11-oxa-3,9,15-triazatricyclo[12.1.1.05,10]hexadeca-1(16),5,7,9-tetraen-4-one |
|---|---|
| PubChem CID | 177333569 |
| Molecular Formula | C25H23F5N6O3 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | (12S)-8-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-7-fluoro-12-methyl-6-(1,2-oxazol-5-ylmethylamino)-11-oxa-3,9,15-triazatricyclo[12.1.1.05,10]hexadeca-1(16),5,7,9-tetraen-4-one |
| SMILES | Cc1c(F)c(N)cc(-c2nc3c(c(NCc4ccno4)c2F)C(=O)NCC2=CC(C[C@H](C)O3)N2)c1C(F)(F)F |
| InChI | InChI=1S/C25H23F5N6O3/c1-10-5-12-6-13(35-12)8-33-23(37)17-22(32-9-14-3-4-34-39-14)20(27)21(36-24(17)38-10)15-7-16(31)19(26)11(2)18(15)25(28,29)30/h3-4,6-7,10,12,35H,5,8-9,31H2,1-2H3,(H,32,36)(H,33,37)/t10-,12?/m0/s1 |
| InChIKey | MLXPIZPEHWSUPX-NUHJPDEHSA-N |
| XLogP | 4.29 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|