C26H23F5N6O2 — CID 177333585
(1S,2S,3S,14R)-7-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-8-fluoro-3-methyl-9-pyrimidin-5-yl-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-trien-11-one (PubChem CID 177333585) has the molecular formula C26H23F5N6O2 and a molecular weight of 546.50 g/mol. Its IUPAC name is (1S,2S,3S,14R)-7-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-8-fluoro-3-methyl-9-pyrimidin-5-yl-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-trien-11-one.
| Compound Name | (1S,2S,3S,14R)-7-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-8-fluoro-3-methyl-9-pyrimidin-5-yl-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-trien-11-one |
|---|---|
| PubChem CID | 177333585 |
| Molecular Formula | C26H23F5N6O2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (1S,2S,3S,14R)-7-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-8-fluoro-3-methyl-9-pyrimidin-5-yl-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-trien-11-one |
| SMILES | Cc1c(F)c(N)cc(-c2nc3c(c(-c4cncnc4)c2F)C(=O)N2C[C@H]4CC[C@H](N4)[C@H]2[C@H](C)O3)c1C(F)(F)F |
| InChI | InChI=1S/C26H23F5N6O2/c1-10-19(26(29,30)31)14(5-15(32)20(10)27)22-21(28)17(12-6-33-9-34-7-12)18-24(36-22)39-11(2)23-16-4-3-13(35-16)8-37(23)25(18)38/h5-7,9,11,13,16,23,35H,3-4,8,32H2,1-2H3/t11-,13+,16-,23+/m0/s1 |
| InChIKey | QMNHMEDKIRVMHE-VIYRKQRSSA-N |
| XLogP | 4.12 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|