C25H26F5N7O2 — CID 177333927
(11R)-6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-10-methyl-4-[(1-methylpyrazol-3-yl)methylamino]-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-trien-2-one (PubChem CID 177333927) has the molecular formula C25H26F5N7O2 and a molecular weight of 551.52 g/mol. Its IUPAC name is (11R)-6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-10-methyl-4-[(1-methylpyrazol-3-yl)methylamino]-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-trien-2-one.
| Compound Name | (11R)-6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-10-methyl-4-[(1-methylpyrazol-3-yl)methylamino]-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 177333927 |
| Molecular Formula | C25H26F5N7O2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | (11R)-6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-10-methyl-4-[(1-methylpyrazol-3-yl)methylamino]-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-trien-2-one |
| SMILES | Cc1c(F)c(N)cc(-c2nc3c(c(NCc4ccn(C)n4)c2F)C(=O)N2CCNC[C@@H]2C(C)O3)c1C(F)(F)F |
| InChI | InChI=1S/C25H26F5N7O2/c1-11-18(25(28,29)30)14(8-15(31)19(11)26)21-20(27)22(33-9-13-4-6-36(3)35-13)17-23(34-21)39-12(2)16-10-32-5-7-37(16)24(17)38/h4,6,8,12,16,32H,5,7,9-10,31H2,1-3H3,(H,33,34)/t12?,16-/m1/s1 |
| InChIKey | SPHWGWJWTWYEFM-PVQCJRHBSA-N |
| XLogP | 3.48 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|