About ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran
ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran (PubChem CID 177334039) has the molecular formula C14H28S
and a molecular weight of 228.44 g/mol. Its IUPAC name is ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran.
Molecular Properties
| Compound Name | ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran |
| PubChem CID | 177334039 |
| Molecular Formula | C14H28S |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran |
| SMILES | CC.CCC1=C(C(C)C)C(C)(C)CSC1 |
| InChI | InChI=1S/C12H22S.C2H6/c1-6-10-7-13-8-12(4,5)11(10)9(2)3;1-2/h9H,6-8H2,1-5H3;1-2H3 |
| InChIKey | LFEZVIYQQIFUIA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
The IUPAC name of ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran (CID 177334039) is ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran.
What is the SMILES notation for ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
The canonical SMILES for ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran is CC.CCC1=C(C(C)C)C(C)(C)CSC1.
What is the InChIKey of ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
The InChIKey is LFEZVIYQQIFUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22S.C2H6/c1-6-10-7-13-8-12(4,5)11(10)9(2)3;1-2/h9H,6-8H2,1-5H3;1-2H3.
What are the key properties of ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran has a molecular weight of 228.44 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran is sourced from PubChem (CID 177334039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).