About 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran
5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran (PubChem CID 177334040) has the molecular formula C12H22S
and a molecular weight of 198.37 g/mol. Its IUPAC name is 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran.
Molecular Properties
| Compound Name | 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran |
| PubChem CID | 177334040 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran |
| SMILES | CCC1=C(C(C)C)C(C)(C)CSC1 |
| InChI | InChI=1S/C12H22S/c1-6-10-7-13-8-12(4,5)11(10)9(2)3/h9H,6-8H2,1-5H3 |
| InChIKey | NKJSHCWHPYXQTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
The IUPAC name of 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran (CID 177334040) is 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran.
What is the SMILES notation for 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
The canonical SMILES for 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran is CCC1=C(C(C)C)C(C)(C)CSC1.
What is the InChIKey of 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
The InChIKey is NKJSHCWHPYXQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22S/c1-6-10-7-13-8-12(4,5)11(10)9(2)3/h9H,6-8H2,1-5H3.
What are the key properties of 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran?
5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran has a molecular weight of 198.37 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,3-dimethyl-4-propan-2-yl-2,6-dihydrothiopyran is sourced from PubChem (CID 177334040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).