C17H16N6 — CID 177334875
7-N-benzylpyrrolo[3,2-f]quinazoline-1,3,7-triamine (PubChem CID 177334875) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is 7-N-benzylpyrrolo[3,2-f]quinazoline-1,3,7-triamine.
| Compound Name | 7-N-benzylpyrrolo[3,2-f]quinazoline-1,3,7-triamine |
|---|---|
| PubChem CID | 177334875 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 7-N-benzylpyrrolo[3,2-f]quinazoline-1,3,7-triamine |
| SMILES | Nc1nc(N)c2c(ccc3c2ccn3NCc2ccccc2)n1 |
| InChI | InChI=1S/C17H16N6/c18-16-15-12-8-9-23(20-10-11-4-2-1-3-5-11)14(12)7-6-13(15)21-17(19)22-16/h1-9,20H,10H2,(H4,18,19,21,22) |
| InChIKey | NSCXXUAJXMEXTQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |