C11H13BrFNO2 — CID 177335006
2-[2-(2-bromo-5-fluorophenyl)ethoxy]-N-methylacetamide (PubChem CID 177335006) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is 2-[2-(2-bromo-5-fluorophenyl)ethoxy]-N-methylacetamide.
| Compound Name | 2-[2-(2-bromo-5-fluorophenyl)ethoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 177335006 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-[2-(2-bromo-5-fluorophenyl)ethoxy]-N-methylacetamide |
| SMILES | CNC(=O)COCCc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H13BrFNO2/c1-14-11(15)7-16-5-4-8-6-9(13)2-3-10(8)12/h2-3,6H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | SSODDWHJQGHJAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|