About CID 177335203
CID 177335203 (PubChem CID 177335203) has the molecular formula C20H19BFN3O2
and a molecular weight of 363.20 g/mol.
Molecular Properties
| Compound Name | CID 177335203 |
| PubChem CID | 177335203 |
| Molecular Formula | C20H19BFN3O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(C(=O)OC)N2CCN(c3ccc(C#N)cc3F)CC2)cc1 |
| InChI | InChI=1S/C20H19BFN3O2/c1-27-20(26)19(15-3-5-16(21)6-4-15)25-10-8-24(9-11-25)18-7-2-14(13-23)12-17(18)22/h2-7,12,19H,8-11H2,1H3 |
| InChIKey | WOCDARGALRMGLO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177335203 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177335203?
The IUPAC name of CID 177335203 (CID 177335203) is not available.
What is the SMILES notation for CID 177335203?
The canonical SMILES for CID 177335203 is [B]c1ccc(C(C(=O)OC)N2CCN(c3ccc(C#N)cc3F)CC2)cc1.
What is the InChIKey of CID 177335203?
The InChIKey is WOCDARGALRMGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BFN3O2/c1-27-20(26)19(15-3-5-16(21)6-4-15)25-10-8-24(9-11-25)18-7-2-14(13-23)12-17(18)22/h2-7,12,19H,8-11H2,1H3.
What are the key properties of CID 177335203?
CID 177335203 has a molecular weight of 363.20 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177335203 is sourced from PubChem (CID 177335203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).