About potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one
potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one (PubChem CID 177336053) has the molecular formula C11H6FKN4O
and a molecular weight of 268.29 g/mol. Its IUPAC name is potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one.
Molecular Properties
| Compound Name | potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one |
| PubChem CID | 177336053 |
| Molecular Formula | C11H6FKN4O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one |
| SMILES | O=c1c2nccn2ccn1-c1cn[c-]c(F)c1.[K+] |
| InChI | InChI=1S/C11H6FN4O.K/c12-8-5-9(7-13-6-8)16-4-3-15-2-1-14-10(15)11(16)17;/h1-5,7H;/q-1;+1 |
| InChIKey | HVUVZVKJZYJMTE-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one?
The IUPAC name of potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one (CID 177336053) is potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one.
What is the SMILES notation for potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one?
The canonical SMILES for potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one is O=c1c2nccn2ccn1-c1cn[c-]c(F)c1.[K+].
What is the InChIKey of potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one?
The InChIKey is HVUVZVKJZYJMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6FN4O.K/c12-8-5-9(7-13-6-8)16-4-3-15-2-1-14-10(15)11(16)17;/h1-5,7H;/q-1;+1.
What are the key properties of potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one?
potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one has a molecular weight of 268.29 g/mol, XLogP of -2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 7-(3-fluoro-2H-pyridin-2-id-5-yl)imidazo[1,2-a]pyrazin-8-one is sourced from PubChem (CID 177336053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).