About 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole
5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole (PubChem CID 177336440) has the molecular formula C10H8ClFN4O
and a molecular weight of 254.65 g/mol. Its IUPAC name is 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole.
Molecular Properties
| Compound Name | 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole |
| PubChem CID | 177336440 |
| Molecular Formula | C10H8ClFN4O |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole |
| SMILES | Fc1c(Cl)cc2c(c1-c1nn[nH]n1)CCCO2 |
| InChI | InChI=1S/C10H8ClFN4O/c11-6-4-7-5(2-1-3-17-7)8(9(6)12)10-13-15-16-14-10/h4H,1-3H2,(H,13,14,15,16) |
| InChIKey | ANGXOFWWYMWFTP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole?
The IUPAC name of 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole (CID 177336440) is 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole.
What is the SMILES notation for 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole?
The canonical SMILES for 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole is Fc1c(Cl)cc2c(c1-c1nn[nH]n1)CCCO2.
What is the InChIKey of 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole?
The InChIKey is ANGXOFWWYMWFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClFN4O/c11-6-4-7-5(2-1-3-17-7)8(9(6)12)10-13-15-16-14-10/h4H,1-3H2,(H,13,14,15,16).
What are the key properties of 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole?
5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole has a molecular weight of 254.65 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-chloro-6-fluoro-3,4-dihydro-2H-chromen-5-yl)-2H-tetrazole is sourced from PubChem (CID 177336440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).