C13H14ClF2N5O — CID 177336456
7-chloro-6-fluoro-4-(4-fluorobutyl)-5-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 177336456) has the molecular formula C13H14ClF2N5O and a molecular weight of 329.74 g/mol. Its IUPAC name is 7-chloro-6-fluoro-4-(4-fluorobutyl)-5-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 7-chloro-6-fluoro-4-(4-fluorobutyl)-5-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 177336456 |
| Molecular Formula | C13H14ClF2N5O |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 7-chloro-6-fluoro-4-(4-fluorobutyl)-5-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | FCCCCN1CCOc2cc(Cl)c(F)c(-c3nn[nH]n3)c21 |
| InChI | InChI=1S/C13H14ClF2N5O/c14-8-7-9-12(10(11(8)16)13-17-19-20-18-13)21(5-6-22-9)4-2-1-3-15/h7H,1-6H2,(H,17,18,19,20) |
| InChIKey | CUZZHUGSZBVQPF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|