About 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine
6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine (PubChem CID 177336537) has the molecular formula C10H10ClN5S
and a molecular weight of 267.75 g/mol. Its IUPAC name is 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine.
Molecular Properties
| Compound Name | 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine |
| PubChem CID | 177336537 |
| Molecular Formula | C10H10ClN5S |
| Molecular Weight | 267.75 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine |
| SMILES | CN1CCSc2c(-c3nn[nH]n3)cc(Cl)cc21 |
| InChI | InChI=1S/C10H10ClN5S/c1-16-2-3-17-9-7(10-12-14-15-13-10)4-6(11)5-8(9)16/h4-5H,2-3H2,1H3,(H,12,13,14,15) |
| InChIKey | MZDNCQVELQEIHW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine?
The IUPAC name of 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine (CID 177336537) is 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine.
What is the SMILES notation for 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine?
The canonical SMILES for 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine is CN1CCSc2c(-c3nn[nH]n3)cc(Cl)cc21.
What is the InChIKey of 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine?
The InChIKey is MZDNCQVELQEIHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN5S/c1-16-2-3-17-9-7(10-12-14-15-13-10)4-6(11)5-8(9)16/h4-5H,2-3H2,1H3,(H,12,13,14,15).
What are the key properties of 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine?
6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine has a molecular weight of 267.75 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-methyl-8-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzothiazine is sourced from PubChem (CID 177336537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).