C11H11ClN4 — CID 177337042
5-(6-chloro-5-methyl-2,3-dihydro-1H-inden-4-yl)-2H-tetrazole (PubChem CID 177337042) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 5-(6-chloro-5-methyl-2,3-dihydro-1H-inden-4-yl)-2H-tetrazole.
| Compound Name | 5-(6-chloro-5-methyl-2,3-dihydro-1H-inden-4-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 177337042 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-(6-chloro-5-methyl-2,3-dihydro-1H-inden-4-yl)-2H-tetrazole |
| SMILES | Cc1c(Cl)cc2c(c1-c1nn[nH]n1)CCC2 |
| InChI | InChI=1S/C11H11ClN4/c1-6-9(12)5-7-3-2-4-8(7)10(6)11-13-15-16-14-11/h5H,2-4H2,1H3,(H,13,14,15,16) |
| InChIKey | RHQSVXGPJKEICO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |