About 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole
5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole (PubChem CID 177337084) has the molecular formula C14H11ClF3N5
and a molecular weight of 341.72 g/mol. Its IUPAC name is 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole.
Molecular Properties
| Compound Name | 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole |
| PubChem CID | 177337084 |
| Molecular Formula | C14H11ClF3N5 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole |
| SMILES | Fc1c(Cl)cc2ccn(CC3CC(F)(F)C3)c2c1-c1nn[nH]n1 |
| InChI | InChI=1S/C14H11ClF3N5/c15-9-3-8-1-2-23(6-7-4-14(17,18)5-7)12(8)10(11(9)16)13-19-21-22-20-13/h1-3,7H,4-6H2,(H,19,20,21,22) |
| InChIKey | ANHBGBSAAXUHLS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole?
The IUPAC name of 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole (CID 177337084) is 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole.
What is the SMILES notation for 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole?
The canonical SMILES for 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole is Fc1c(Cl)cc2ccn(CC3CC(F)(F)C3)c2c1-c1nn[nH]n1.
What is the InChIKey of 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole?
The InChIKey is ANHBGBSAAXUHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClF3N5/c15-9-3-8-1-2-23(6-7-4-14(17,18)5-7)12(8)10(11(9)16)13-19-21-22-20-13/h1-3,7H,4-6H2,(H,19,20,21,22).
What are the key properties of 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole?
5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole has a molecular weight of 341.72 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[(3,3-difluorocyclobutyl)methyl]-6-fluoro-7-(2H-tetrazol-5-yl)indole is sourced from PubChem (CID 177337084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).