About N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen
N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen (PubChem CID 177337836) has the molecular formula C10H20N4OS
and a molecular weight of 244.36 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen |
| PubChem CID | 177337836 |
| Molecular Formula | C10H20N4OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen |
| SMILES | Nc1nnc(NC(=O)CC2CCCCC2)s1.[H][H].[H][H] |
| InChI | InChI=1S/C10H16N4OS.2H2/c11-9-13-14-10(16-9)12-8(15)6-7-4-2-1-3-5-7;;/h7H,1-6H2,(H2,11,13)(H,12,14,15);2*1H |
| InChIKey | GAHDIAWRIUDZSC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen?
The IUPAC name of N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen (CID 177337836) is N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen.
What is the SMILES notation for N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen?
The canonical SMILES for N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen is Nc1nnc(NC(=O)CC2CCCCC2)s1.[H][H].[H][H].
What is the InChIKey of N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen?
The InChIKey is GAHDIAWRIUDZSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS.2H2/c11-9-13-14-10(16-9)12-8(15)6-7-4-2-1-3-5-7;;/h7H,1-6H2,(H2,11,13)(H,12,14,15);2*1H.
What are the key properties of N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen?
N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen has a molecular weight of 244.36 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide;molecular hydrogen is sourced from PubChem (CID 177337836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).