C36H46N2O6Si2 — CID 177338188
1,1-bis(4-trimethylsilylphenyl)prop-1-en-2-yl (2S)-2-[[3-(2-cyclopropylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]propanoate (PubChem CID 177338188) has the molecular formula C36H46N2O6Si2 and a molecular weight of 658.94 g/mol. Its IUPAC name is 1,1-bis(4-trimethylsilylphenyl)prop-1-en-2-yl (2S)-2-[[3-(2-cyclopropylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]propanoate.
| Compound Name | 1,1-bis(4-trimethylsilylphenyl)prop-1-en-2-yl (2S)-2-[[3-(2-cyclopropylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 177338188 |
| Molecular Formula | C36H46N2O6Si2 |
| Molecular Weight | 658.94 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | 1,1-bis(4-trimethylsilylphenyl)prop-1-en-2-yl (2S)-2-[[3-(2-cyclopropylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]propanoate |
| SMILES | COc1ccnc(C(=O)N[C@@H](C)C(=O)OC(C)=C(c2ccc([Si](C)(C)C)cc2)c2ccc([Si](C)(C)C)cc2)c1OC(=O)CC1CC1 |
| InChI | InChI=1S/C36H46N2O6Si2/c1-23(38-35(40)33-34(30(42-3)20-21-37-33)44-31(39)22-25-10-11-25)36(41)43-24(2)32(26-12-16-28(17-13-26)45(4,5)6)27-14-18-29(19-15-27)46(7,8)9/h12-21,23,25H,10-11,22H2,1-9H3,(H,38,40)/t23-/m0/s1 |
| InChIKey | OATDDROBEARXKR-QHCPKHFHSA-N |
| XLogP | 6.03 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|