C41H40ClN7O5 — CID 177338773
3-[8-[4-[4-[2-chloro-4-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]phenyl]-3-oxopiperazin-1-yl]cyclohexyl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione (PubChem CID 177338773) has the molecular formula C41H40ClN7O5 and a molecular weight of 746.27 g/mol. Its IUPAC name is 3-[8-[4-[4-[2-chloro-4-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]phenyl]-3-oxopiperazin-1-yl]cyclohexyl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione.
| Compound Name | 3-[8-[4-[4-[2-chloro-4-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]phenyl]-3-oxopiperazin-1-yl]cyclohexyl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177338773 |
| Molecular Formula | C41H40ClN7O5 |
| Molecular Weight | 746.27 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | 3-[8-[4-[4-[2-chloro-4-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]phenyl]-3-oxopiperazin-1-yl]cyclohexyl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CCOc3c(C4CCC(N5CCN(c6ccc(-n7ccc8nnc(-c9ccccc9O)cc87)cc6Cl)C(=O)C5)CC4)cccc32)C(=O)N1 |
| InChI | InChI=1S/C41H40ClN7O5/c42-30-22-27(47-17-16-31-36(47)23-32(45-44-31)29-4-1-2-7-37(29)50)12-13-33(30)49-19-18-46(24-39(49)52)26-10-8-25(9-11-26)28-5-3-6-34-40(28)54-21-20-48(34)35-14-15-38(51)43-41(35)53/h1-7,12-13,16-17,22-23,25-26,35,50H,8-11,14-15,18-21,24H2,(H,43,51,53) |
| InChIKey | PRESLVDJKIGCRS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.27 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|