About 4-methyloctyl octanoate
4-methyloctyl octanoate (PubChem CID 177339666) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 4-methyloctyl octanoate.
Molecular Properties
| Compound Name | 4-methyloctyl octanoate |
| PubChem CID | 177339666 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 4-methyloctyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCC(C)CCCC |
| InChI | InChI=1S/C17H34O2/c1-4-6-8-9-10-14-17(18)19-15-11-13-16(3)12-7-5-2/h16H,4-15H2,1-3H3 |
| InChIKey | OOHRJNWWOOINFS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyloctyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyloctyl octanoate?
The IUPAC name of 4-methyloctyl octanoate (CID 177339666) is 4-methyloctyl octanoate.
What is the SMILES notation for 4-methyloctyl octanoate?
The canonical SMILES for 4-methyloctyl octanoate is CCCCCCCC(=O)OCCCC(C)CCCC.
What is the InChIKey of 4-methyloctyl octanoate?
The InChIKey is OOHRJNWWOOINFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-4-6-8-9-10-14-17(18)19-15-11-13-16(3)12-7-5-2/h16H,4-15H2,1-3H3.
What are the key properties of 4-methyloctyl octanoate?
4-methyloctyl octanoate has a molecular weight of 270.46 g/mol, XLogP of 5.50, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyloctyl octanoate is sourced from PubChem (CID 177339666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).