About 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane
4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane (PubChem CID 177340747) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane.
Molecular Properties
| Compound Name | 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane |
| PubChem CID | 177340747 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane |
| SMILES | C=C1NC(CC)(CCC)CCN1CCC |
| InChI | InChI=1S/C13H26N2/c1-5-8-13(7-3)9-11-15(10-6-2)12(4)14-13/h14H,4-11H2,1-3H3 |
| InChIKey | GZAKLVMKWNXQEA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane?
The IUPAC name of 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane (CID 177340747) is 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane.
What is the SMILES notation for 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane?
The canonical SMILES for 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane is C=C1NC(CC)(CCC)CCN1CCC.
What is the InChIKey of 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane?
The InChIKey is GZAKLVMKWNXQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-5-8-13(7-3)9-11-15(10-6-2)12(4)14-13/h14H,4-11H2,1-3H3.
What are the key properties of 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane?
4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane has a molecular weight of 210.36 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylidene-1,4-dipropyl-1,3-diazinane is sourced from PubChem (CID 177340747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).