C29H42ClNO9Si — CID 177341722
[(2R,3S,4R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4,5-dihydroxyoxan-3-yl] carbamate (PubChem CID 177341722) has the molecular formula C29H42ClNO9Si and a molecular weight of 612.19 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4,5-dihydroxyoxan-3-yl] carbamate.
| Compound Name | [(2R,3S,4R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4,5-dihydroxyoxan-3-yl] carbamate |
|---|---|
| PubChem CID | 177341722 |
| Molecular Formula | C29H42ClNO9Si |
| Molecular Weight | 612.19 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4,5-dihydroxyoxan-3-yl] carbamate |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](OCCOCCOCCCl)[C@@H](O)[C@@H](O)[C@@H]1OC(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H42ClNO9Si/c1-29(2,3)41(21-10-6-4-7-11-21,22-12-8-5-9-13-22)38-20-23-26(40-28(31)34)24(32)25(33)27(39-23)37-19-18-36-17-16-35-15-14-30/h4-13,23-27,32-33H,14-20H2,1-3H3,(H2,31,34)/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | QBWCXIACILQEJC-SEFGFODJSA-N |
| XLogP | 1.76 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|