C32H46ClNO9Si — CID 177341738
[(3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] carbamate (PubChem CID 177341738) has the molecular formula C32H46ClNO9Si and a molecular weight of 652.26 g/mol. Its IUPAC name is [(3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] carbamate.
| Compound Name | [(3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] carbamate |
|---|---|
| PubChem CID | 177341738 |
| Molecular Formula | C32H46ClNO9Si |
| Molecular Weight | 652.26 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | [(3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] carbamate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](OCCOCCOCCCl)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]2OC(N)=O |
| InChI | InChI=1S/C32H46ClNO9Si/c1-31(2,3)44(23-12-8-6-9-13-23,24-14-10-7-11-15-24)39-22-25-26(41-30(34)35)27-28(43-32(4,5)42-27)29(40-25)38-21-20-37-19-18-36-17-16-33/h6-15,25-29H,16-22H2,1-5H3,(H2,34,35)/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | IQTOBPVYHOWTMF-PNHLWVRCSA-N |
| XLogP | 3.56 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|