About (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one
(E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one (PubChem CID 177342677) has the molecular formula C11H17F2NO2
and a molecular weight of 233.26 g/mol. Its IUPAC name is (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one.
Molecular Properties
| Compound Name | (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one |
| PubChem CID | 177342677 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one |
| SMILES | CC(C)OC(N)C(=O)/C=C/CC1CC1(F)F |
| InChI | InChI=1S/C11H17F2NO2/c1-7(2)16-10(14)9(15)5-3-4-8-6-11(8,12)13/h3,5,7-8,10H,4,6,14H2,1-2H3/b5-3+ |
| InChIKey | QVYAWJGTZJUSBG-HWKANZROSA-N |
| XLogP | 1.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one?
The IUPAC name of (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one (CID 177342677) is (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one.
What is the SMILES notation for (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one?
The canonical SMILES for (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one is CC(C)OC(N)C(=O)/C=C/CC1CC1(F)F.
What is the InChIKey of (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one?
The InChIKey is QVYAWJGTZJUSBG-HWKANZROSA-N. The full InChI is InChI=1S/C11H17F2NO2/c1-7(2)16-10(14)9(15)5-3-4-8-6-11(8,12)13/h3,5,7-8,10H,4,6,14H2,1-2H3/b5-3+.
What are the key properties of (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one?
(E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one has a molecular weight of 233.26 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-amino-5-(2,2-difluorocyclopropyl)-1-propan-2-yloxypent-3-en-2-one is sourced from PubChem (CID 177342677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).