C13H18FN3 — CID 177342696
N-[(3E)-5-(2-fluoro-2-methylcyclopropyl)penta-1,3-dien-2-yl]-1-methylpyrazol-3-amine (PubChem CID 177342696) has the molecular formula C13H18FN3 and a molecular weight of 235.31 g/mol. Its IUPAC name is N-[(3E)-5-(2-fluoro-2-methylcyclopropyl)penta-1,3-dien-2-yl]-1-methylpyrazol-3-amine.
| Compound Name | N-[(3E)-5-(2-fluoro-2-methylcyclopropyl)penta-1,3-dien-2-yl]-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 177342696 |
| Molecular Formula | C13H18FN3 |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N-[(3E)-5-(2-fluoro-2-methylcyclopropyl)penta-1,3-dien-2-yl]-1-methylpyrazol-3-amine |
| SMILES | C=C(/C=C/CC1CC1(C)F)Nc1ccn(C)n1 |
| InChI | InChI=1S/C13H18FN3/c1-10(15-12-7-8-17(3)16-12)5-4-6-11-9-13(11,2)14/h4-5,7-8,11H,1,6,9H2,2-3H3,(H,15,16)/b5-4+ |
| InChIKey | CMKCVAOKSCHCPX-SNAWJCMRSA-N |
| XLogP | 3.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|