C15H14N2 — CID 177342756
3,7-diazabicyclo[11.4.0]heptadeca-1,3,5,8,10,12,14,16-octaene (PubChem CID 177342756) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3,7-diazabicyclo[11.4.0]heptadeca-1,3,5,8,10,12,14,16-octaene.
| Compound Name | 3,7-diazabicyclo[11.4.0]heptadeca-1,3,5,8,10,12,14,16-octaene |
|---|---|
| PubChem CID | 177342756 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3,7-diazabicyclo[11.4.0]heptadeca-1,3,5,8,10,12,14,16-octaene |
| SMILES | c1cc[nH]cccncc2ccccc2cc1 |
| InChI | InChI=1S/C15H14N2/c1-2-7-14-8-3-4-9-15(14)13-17-12-6-11-16-10-5-1/h1-13,16H/b2-1-,10-5+,11-6+,14-7+,15-13-,17-12- |
| InChIKey | PQNPKFFWFHWKGR-IUOGNRCDSA-N |
| XLogP | 3.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |