C27H37FN2 — CID 177342864
1-[3-ethyl-2-[5-[1-(2,4,5-trimethylphenyl)ethylideneamino]hex-5-enyl]phenyl]-1-fluoroethanamine (PubChem CID 177342864) has the molecular formula C27H37FN2 and a molecular weight of 408.61 g/mol. Its IUPAC name is 1-[3-ethyl-2-[5-[1-(2,4,5-trimethylphenyl)ethylideneamino]hex-5-enyl]phenyl]-1-fluoroethanamine.
| Compound Name | 1-[3-ethyl-2-[5-[1-(2,4,5-trimethylphenyl)ethylideneamino]hex-5-enyl]phenyl]-1-fluoroethanamine |
|---|---|
| PubChem CID | 177342864 |
| Molecular Formula | C27H37FN2 |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-[3-ethyl-2-[5-[1-(2,4,5-trimethylphenyl)ethylideneamino]hex-5-enyl]phenyl]-1-fluoroethanamine |
| SMILES | C=C(CCCCc1c(CC)cccc1C(C)(N)F)/N=C(\C)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C27H37FN2/c1-8-23-13-11-15-26(27(7,28)29)24(23)14-10-9-12-21(5)30-22(6)25-17-19(3)18(2)16-20(25)4/h11,13,15-17H,5,8-10,12,14,29H2,1-4,6-7H3/b30-22+ |
| InChIKey | TXKFGVCUGASGNK-JBASAIQMSA-N |
| XLogP | 7.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|