C16H30O6 — CID 177343122
[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 3,3,5,5-tetramethylhexanoate (PubChem CID 177343122) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 3,3,5,5-tetramethylhexanoate.
| Compound Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 3,3,5,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 177343122 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 3,3,5,5-tetramethylhexanoate |
| SMILES | CC(C)(C)CC(C)(C)CC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30O6/c1-15(2,3)9-16(4,5)6-12(19)21-8-11(18)14-13(20)10(17)7-22-14/h10-11,13-14,17-18,20H,6-9H2,1-5H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | JDWIFDHEHLATFP-OIMNJJJWSA-N |
| XLogP | 0.86 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |