C12H15FN2O2 — CID 177343889
3-[[(3E,5Z)-2-fluorohepta-1,3,5-trien-4-yl]amino]piperidine-2,6-dione (PubChem CID 177343889) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-[[(3E,5Z)-2-fluorohepta-1,3,5-trien-4-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[(3E,5Z)-2-fluorohepta-1,3,5-trien-4-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177343889 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-[[(3E,5Z)-2-fluorohepta-1,3,5-trien-4-yl]amino]piperidine-2,6-dione |
| SMILES | C=C(F)/C=C(\C=C/C)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H15FN2O2/c1-3-4-9(7-8(2)13)14-10-5-6-11(16)15-12(10)17/h3-4,7,10,14H,2,5-6H2,1H3,(H,15,16,17)/b4-3-,9-7+ |
| InChIKey | UHFAMSYWXPLSEL-GAWLIRPZSA-N |
| XLogP | 1.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|