C21H27FN6O8 — CID 177344187
2-fluoro-4-[[4-[formyl(oxan-4-yl)amino]-5-[methyl(1,1,2,2,2-pentahydroxyethyl)amino]pyrimidin-2-yl]amino]-5-methylbenzamide (PubChem CID 177344187) has the molecular formula C21H27FN6O8 and a molecular weight of 510.48 g/mol. Its IUPAC name is 2-fluoro-4-[[4-[formyl(oxan-4-yl)amino]-5-[methyl(1,1,2,2,2-pentahydroxyethyl)amino]pyrimidin-2-yl]amino]-5-methylbenzamide.
| Compound Name | 2-fluoro-4-[[4-[formyl(oxan-4-yl)amino]-5-[methyl(1,1,2,2,2-pentahydroxyethyl)amino]pyrimidin-2-yl]amino]-5-methylbenzamide |
|---|---|
| PubChem CID | 177344187 |
| Molecular Formula | C21H27FN6O8 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2-fluoro-4-[[4-[formyl(oxan-4-yl)amino]-5-[methyl(1,1,2,2,2-pentahydroxyethyl)amino]pyrimidin-2-yl]amino]-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)c(F)cc1Nc1ncc(N(C)C(O)(O)C(O)(O)O)c(N(C=O)C2CCOCC2)n1 |
| InChI | InChI=1S/C21H27FN6O8/c1-11-7-13(17(23)30)14(22)8-15(11)25-19-24-9-16(27(2)20(31,32)21(33,34)35)18(26-19)28(10-29)12-3-5-36-6-4-12/h7-10,12,31-35H,3-6H2,1-2H3,(H2,23,30)(H,24,25,26) |
| InChIKey | PPIKIKNVTUFKST-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 214.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|