C22H28N6O4 — CID 177344211
2-ethoxy-4-[[7-ethyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-5-methylbenzamide (PubChem CID 177344211) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-ethoxy-4-[[7-ethyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-5-methylbenzamide.
| Compound Name | 2-ethoxy-4-[[7-ethyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-5-methylbenzamide |
|---|---|
| PubChem CID | 177344211 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-ethoxy-4-[[7-ethyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-5-methylbenzamide |
| SMILES | CCOc1cc(Nc2ncc3c(n2)n(C2CCOCC2)c(=O)n3CC)c(C)cc1C(N)=O |
| InChI | InChI=1S/C22H28N6O4/c1-4-27-17-12-24-21(26-20(17)28(22(27)30)14-6-8-31-9-7-14)25-16-11-18(32-5-2)15(19(23)29)10-13(16)3/h10-12,14H,4-9H2,1-3H3,(H2,23,29)(H,24,25,26) |
| InChIKey | MDFANSIHBCIOKD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |