About CID 177344238
CID 177344238 (PubChem CID 177344238) has the molecular formula C27H45OSi
and a molecular weight of 413.74 g/mol.
Molecular Properties
| Compound Name | CID 177344238 |
| PubChem CID | 177344238 |
| Molecular Formula | C27H45OSi |
| Molecular Weight | 413.74 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(C[C@H]1CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C)C(C)(C)C |
| InChI | InChI=1S/C27H45OSi/c1-25(2,3)24(28-29(6)7)18-20-12-14-22-21-13-11-19-10-8-9-16-26(19,4)23(21)15-17-27(20,22)5/h11,13,20,22-24H,8-10,12,14-18H2,1-7H3/t20-,22+,23+,24?,26+,27-/m1/s1 |
| InChIKey | VEESEGMTPLKBFD-SLBWBXKSSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.74 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177344238 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177344238?
The IUPAC name of CID 177344238 (CID 177344238) is not available.
What is the SMILES notation for CID 177344238?
The canonical SMILES for CID 177344238 is C[Si](C)OC(C[C@H]1CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C)C(C)(C)C.
What is the InChIKey of CID 177344238?
The InChIKey is VEESEGMTPLKBFD-SLBWBXKSSA-N. The full InChI is InChI=1S/C27H45OSi/c1-25(2,3)24(28-29(6)7)18-20-12-14-22-21-13-11-19-10-8-9-16-26(19,4)23(21)15-17-27(20,22)5/h11,13,20,22-24H,8-10,12,14-18H2,1-7H3/t20-,22+,23+,24?,26+,27-/m1/s1.
What are the key properties of CID 177344238?
CID 177344238 has a molecular weight of 413.74 g/mol, XLogP of 7.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177344238 is sourced from PubChem (CID 177344238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).