About ethane;3-ethyl-4-methylfuran-2,5-dione
ethane;3-ethyl-4-methylfuran-2,5-dione (PubChem CID 177345149) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is ethane;3-ethyl-4-methylfuran-2,5-dione.
Molecular Properties
| Compound Name | ethane;3-ethyl-4-methylfuran-2,5-dione |
| PubChem CID | 177345149 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | ethane;3-ethyl-4-methylfuran-2,5-dione |
| SMILES | CC.CCC1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C7H8O3.C2H6/c1-3-5-4(2)6(8)10-7(5)9;1-2/h3H2,1-2H3;1-2H3 |
| InChIKey | CEZBPSDTMAFAMC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethyl-4-methylfuran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-4-methylfuran-2,5-dione?
The IUPAC name of ethane;3-ethyl-4-methylfuran-2,5-dione (CID 177345149) is ethane;3-ethyl-4-methylfuran-2,5-dione.
What is the SMILES notation for ethane;3-ethyl-4-methylfuran-2,5-dione?
The canonical SMILES for ethane;3-ethyl-4-methylfuran-2,5-dione is CC.CCC1=C(C)C(=O)OC1=O.
What is the InChIKey of ethane;3-ethyl-4-methylfuran-2,5-dione?
The InChIKey is CEZBPSDTMAFAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3.C2H6/c1-3-5-4(2)6(8)10-7(5)9;1-2/h3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-ethyl-4-methylfuran-2,5-dione?
ethane;3-ethyl-4-methylfuran-2,5-dione has a molecular weight of 170.21 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-4-methylfuran-2,5-dione is sourced from PubChem (CID 177345149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).