About ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine
ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine (PubChem CID 177346169) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine |
| PubChem CID | 177346169 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C(C)=C(/F)N=C.CC |
| InChI | InChI=1S/C6H8FN.C2H6/c1-4-5(2)6(7)8-3;1-2/h4H,1,3H2,2H3;1-2H3/b6-5-; |
| InChIKey | RCWORRLRIJHMLL-YSMBQZINSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine?
The IUPAC name of ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine (CID 177346169) is ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine.
What is the SMILES notation for ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine?
The canonical SMILES for ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine is C=C/C(C)=C(/F)N=C.CC.
What is the InChIKey of ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine?
The InChIKey is RCWORRLRIJHMLL-YSMBQZINSA-N. The full InChI is InChI=1S/C6H8FN.C2H6/c1-4-5(2)6(7)8-3;1-2/h4H,1,3H2,2H3;1-2H3/b6-5-;.
What are the key properties of ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine?
ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine has a molecular weight of 143.20 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(1E)-1-fluoro-2-methylbuta-1,3-dienyl]methanimine is sourced from PubChem (CID 177346169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).