About 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene
6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene (PubChem CID 177346546) has the molecular formula C28H31ClN2O
and a molecular weight of 447.02 g/mol. Its IUPAC name is 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene.
Molecular Properties
| Compound Name | 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene |
| PubChem CID | 177346546 |
| Molecular Formula | C28H31ClN2O |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene |
| SMILES | CCc1ccccc1.Cc1c(Cl)cccc1C1(Nc2ccccc2)CC2(CN(C=O)C2)C1 |
| InChI | InChI=1S/C20H21ClN2O.C8H10/c1-15-17(8-5-9-18(15)21)20(22-16-6-3-2-4-7-16)10-19(11-20)12-23(13-19)14-24;1-2-8-6-4-3-5-7-8/h2-9,14,22H,10-13H2,1H3;3-7H,2H2,1H3 |
| InChIKey | GYUGSFALUAGLNN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene?
The IUPAC name of 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene (CID 177346546) is 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene.
What is the SMILES notation for 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene?
The canonical SMILES for 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene is CCc1ccccc1.Cc1c(Cl)cccc1C1(Nc2ccccc2)CC2(CN(C=O)C2)C1.
What is the InChIKey of 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene?
The InChIKey is GYUGSFALUAGLNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN2O.C8H10/c1-15-17(8-5-9-18(15)21)20(22-16-6-3-2-4-7-16)10-19(11-20)12-23(13-19)14-24;1-2-8-6-4-3-5-7-8/h2-9,14,22H,10-13H2,1H3;3-7H,2H2,1H3.
What are the key properties of 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene?
6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene has a molecular weight of 447.02 g/mol, XLogP of 6.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carbaldehyde;ethylbenzene is sourced from PubChem (CID 177346546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).