C13H22N2O — CID 177347267
ethane;N-ethyl-6-propan-2-ylpyridine-2-carboxamide (PubChem CID 177347267) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;N-ethyl-6-propan-2-ylpyridine-2-carboxamide.
| Compound Name | ethane;N-ethyl-6-propan-2-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 177347267 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | ethane;N-ethyl-6-propan-2-ylpyridine-2-carboxamide |
| SMILES | CC.CCNC(=O)c1cccc(C(C)C)n1 |
| InChI | InChI=1S/C11H16N2O.C2H6/c1-4-12-11(14)10-7-5-6-9(13-10)8(2)3;1-2/h5-8H,4H2,1-3H3,(H,12,14);1-2H3 |
| InChIKey | JNENVSDSWGSLAI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |