About 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene
5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene (PubChem CID 177350599) has the molecular formula C15H20FN
and a molecular weight of 233.33 g/mol. Its IUPAC name is 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene.
Molecular Properties
| Compound Name | 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene |
| PubChem CID | 177350599 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene |
| SMILES | CC(C)N1CC2CC1C=C2C1=CCCC=C1F |
| InChI | InChI=1S/C15H20FN/c1-10(2)17-9-11-7-12(17)8-14(11)13-5-3-4-6-15(13)16/h5-6,8,10-12H,3-4,7,9H2,1-2H3 |
| InChIKey | NEIXXLCYHGDBCZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene?
The IUPAC name of 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene (CID 177350599) is 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene.
What is the SMILES notation for 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene?
The canonical SMILES for 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene is CC(C)N1CC2CC1C=C2C1=CCCC=C1F.
What is the InChIKey of 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene?
The InChIKey is NEIXXLCYHGDBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FN/c1-10(2)17-9-11-7-12(17)8-14(11)13-5-3-4-6-15(13)16/h5-6,8,10-12H,3-4,7,9H2,1-2H3.
What are the key properties of 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene?
5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene has a molecular weight of 233.33 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluorocyclohexa-1,5-dien-1-yl)-2-propan-2-yl-2-azabicyclo[2.2.1]hept-5-ene is sourced from PubChem (CID 177350599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).