C15H15FN4O2 — CID 177350992
N-(3-cyanobut-3-enyl)-2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)acetamide (PubChem CID 177350992) has the molecular formula C15H15FN4O2 and a molecular weight of 302.31 g/mol. Its IUPAC name is N-(3-cyanobut-3-enyl)-2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)acetamide.
| Compound Name | N-(3-cyanobut-3-enyl)-2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 177350992 |
| Molecular Formula | C15H15FN4O2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(3-cyanobut-3-enyl)-2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)acetamide |
| SMILES | C=C(C#N)CCNC(=O)CN1Cc2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C15H15FN4O2/c1-10(7-17)4-5-18-14(21)9-20-8-11-6-12(16)2-3-13(11)19-15(20)22/h2-3,6H,1,4-5,8-9H2,(H,18,21)(H,19,22) |
| InChIKey | DSEVFDIULONDPL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|