C16H14BrNO6 — CID 177352354
2-[4-(2-bromo-5-methoxyphenoxy)-2-nitrophenyl]-1,3-dioxolane (PubChem CID 177352354) has the molecular formula C16H14BrNO6 and a molecular weight of 396.19 g/mol. Its IUPAC name is 2-[4-(2-bromo-5-methoxyphenoxy)-2-nitrophenyl]-1,3-dioxolane.
| Compound Name | 2-[4-(2-bromo-5-methoxyphenoxy)-2-nitrophenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 177352354 |
| Molecular Formula | C16H14BrNO6 |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 2-[4-(2-bromo-5-methoxyphenoxy)-2-nitrophenyl]-1,3-dioxolane |
| SMILES | COc1ccc(Br)c(Oc2ccc(C3OCCO3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H14BrNO6/c1-21-10-3-5-13(17)15(9-10)24-11-2-4-12(14(8-11)18(19)20)16-22-6-7-23-16/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | ANUIEUYEOJQCBZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|