C15H22N2O — CID 177353615
(2E,3Z)-2-ethylidene-N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-4-yl)hexa-3,5-dienamide (PubChem CID 177353615) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-4-yl)hexa-3,5-dienamide.
| Compound Name | (2E,3Z)-2-ethylidene-N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-4-yl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 177353615 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (2E,3Z)-2-ethylidene-N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-4-yl)hexa-3,5-dienamide |
| SMILES | C=C(/C=C\C(=C/C)C(=O)N(C)C)C1=CCNCC1 |
| InChI | InChI=1S/C15H22N2O/c1-5-13(15(18)17(3)4)7-6-12(2)14-8-10-16-11-9-14/h5-8,16H,2,9-11H2,1,3-4H3/b7-6-,13-5+ |
| InChIKey | FHAQBJUFYGDESX-ZQNRWWJISA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|