C31H38N6O2 — CID 177354076
4-[1-[[4-[6-(2-methoxyethylamino)-3-pyridinyl]-1-methylpyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-4-yl]-N,N-dimethylbenzamide (PubChem CID 177354076) has the molecular formula C31H38N6O2 and a molecular weight of 526.69 g/mol. Its IUPAC name is 4-[1-[[4-[6-(2-methoxyethylamino)-3-pyridinyl]-1-methylpyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-4-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[1-[[4-[6-(2-methoxyethylamino)-3-pyridinyl]-1-methylpyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-4-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 177354076 |
| Molecular Formula | C31H38N6O2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 4-[1-[[4-[6-(2-methoxyethylamino)-3-pyridinyl]-1-methylpyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-4-yl]-N,N-dimethylbenzamide |
| SMILES | COCCNc1ccc(-c2ccnc3c2cc(CN2CCC(c4ccc(C(=O)N(C)C)cc4)CC2)n3C)cn1 |
| InChI | InChI=1S/C31H38N6O2/c1-35(2)31(38)24-7-5-22(6-8-24)23-12-16-37(17-13-23)21-26-19-28-27(11-14-33-30(28)36(26)3)25-9-10-29(34-20-25)32-15-18-39-4/h5-11,14,19-20,23H,12-13,15-18,21H2,1-4H3,(H,32,34) |
| InChIKey | WYOKPGPMEWDWEA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|