About 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane
5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane (PubChem CID 177355002) has the molecular formula C11H15BrN2O
and a molecular weight of 271.16 g/mol. Its IUPAC name is 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane.
Molecular Properties
| Compound Name | 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane |
| PubChem CID | 177355002 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane |
| SMILES | CC.Cc1cc2[nH]c(=O)n(C)c2cc1Br |
| InChI | InChI=1S/C9H9BrN2O.C2H6/c1-5-3-7-8(4-6(5)10)12(2)9(13)11-7;1-2/h3-4H,1-2H3,(H,11,13);1-2H3 |
| InChIKey | YIABYXQPKROSCS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane?
The IUPAC name of 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane (CID 177355002) is 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane.
What is the SMILES notation for 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane?
The canonical SMILES for 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane is CC.Cc1cc2[nH]c(=O)n(C)c2cc1Br.
What is the InChIKey of 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane?
The InChIKey is YIABYXQPKROSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O.C2H6/c1-5-3-7-8(4-6(5)10)12(2)9(13)11-7;1-2/h3-4H,1-2H3,(H,11,13);1-2H3.
What are the key properties of 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane?
5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane has a molecular weight of 271.16 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,6-dimethyl-1H-benzimidazol-2-one;ethane is sourced from PubChem (CID 177355002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).