About N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine
N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine (PubChem CID 177355849) has the molecular formula C8H8F2N2
and a molecular weight of 170.16 g/mol. Its IUPAC name is N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine.
Molecular Properties
| Compound Name | N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine |
| PubChem CID | 177355849 |
| Molecular Formula | C8H8F2N2 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine |
| SMILES | C=NN1C=C(F)C(F)=C/C1=C/C |
| InChI | InChI=1S/C8H8F2N2/c1-3-6-4-7(9)8(10)5-12(6)11-2/h3-5H,2H2,1H3/b6-3- |
| InChIKey | SSXWEJDCYZMSCE-UTCJRWHESA-N |
| XLogP | 2.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine?
The IUPAC name of N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine (CID 177355849) is N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine.
What is the SMILES notation for N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine?
The canonical SMILES for N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine is C=NN1C=C(F)C(F)=C/C1=C/C.
What is the InChIKey of N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine?
The InChIKey is SSXWEJDCYZMSCE-UTCJRWHESA-N. The full InChI is InChI=1S/C8H8F2N2/c1-3-6-4-7(9)8(10)5-12(6)11-2/h3-5H,2H2,1H3/b6-3-.
What are the key properties of N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine?
N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine has a molecular weight of 170.16 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z)-2-ethylidene-4,5-difluoro-1-pyridinyl]methanimine is sourced from PubChem (CID 177355849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).