C23H38FN5O2 — CID 177356074
4-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]anilino]-5-methoxyhexanamide (PubChem CID 177356074) has the molecular formula C23H38FN5O2 and a molecular weight of 435.59 g/mol. Its IUPAC name is 4-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]anilino]-5-methoxyhexanamide.
| Compound Name | 4-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]anilino]-5-methoxyhexanamide |
|---|---|
| PubChem CID | 177356074 |
| Molecular Formula | C23H38FN5O2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 4-[3-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]anilino]-5-methoxyhexanamide |
| SMILES | COC(C)C(CCC(N)=O)Nc1ccc(N2CCN(CC3CCNCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H38FN5O2/c1-17(31-2)21(4-6-23(25)30)27-19-3-5-22(20(24)15-19)29-13-11-28(12-14-29)16-18-7-9-26-10-8-18/h3,5,15,17-18,21,26-27H,4,6-14,16H2,1-2H3,(H2,25,30) |
| InChIKey | ZRCOZIGYAKMXGY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|