About 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide
4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 177356279) has the molecular formula C16H22FNO
and a molecular weight of 263.36 g/mol. Its IUPAC name is 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 177356279 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CN(C)C(=O)C1=CC(F)=C(C2=CCCCCC2)CC1 |
| InChI | InChI=1S/C16H22FNO/c1-18(2)16(19)13-9-10-14(15(17)11-13)12-7-5-3-4-6-8-12/h7,11H,3-6,8-10H2,1-2H3 |
| InChIKey | GFUIGPLGFURCPX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide (CID 177356279) is 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide is CN(C)C(=O)C1=CC(F)=C(C2=CCCCCC2)CC1.
What is the InChIKey of 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide?
The InChIKey is GFUIGPLGFURCPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNO/c1-18(2)16(19)13-9-10-14(15(17)11-13)12-7-5-3-4-6-8-12/h7,11H,3-6,8-10H2,1-2H3.
What are the key properties of 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide?
4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide has a molecular weight of 263.36 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohepten-1-yl)-3-fluoro-N,N-dimethylcyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 177356279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).