C17H18N2O3 — CID 177356532
3-(6-methyl-3-oxospiro[2H-quinoline-4,1'-cyclopropane]-1-yl)piperidine-2,6-dione (PubChem CID 177356532) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(6-methyl-3-oxospiro[2H-quinoline-4,1'-cyclopropane]-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-methyl-3-oxospiro[2H-quinoline-4,1'-cyclopropane]-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 177356532 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(6-methyl-3-oxospiro[2H-quinoline-4,1'-cyclopropane]-1-yl)piperidine-2,6-dione |
| SMILES | Cc1ccc2c(c1)C1(CC1)C(=O)CN2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H18N2O3/c1-10-2-3-12-11(8-10)17(6-7-17)14(20)9-19(12)13-4-5-15(21)18-16(13)22/h2-3,8,13H,4-7,9H2,1H3,(H,18,21,22) |
| InChIKey | IXQXQFSJYLCJCO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|