About N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide
N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide (PubChem CID 177356847) has the molecular formula C10H16F3N3O4
and a molecular weight of 299.25 g/mol. Its IUPAC name is N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide |
| PubChem CID | 177356847 |
| Molecular Formula | C10H16F3N3O4 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide |
| SMILES | CC(=O)NCOCCN(CC(N)=O)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O4/c1-7(17)15-6-20-3-2-16(5-8(14)18)9(19)4-10(11,12)13/h2-6H2,1H3,(H2,14,18)(H,15,17) |
| InChIKey | JITJGGVVYQBSAX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide (CID 177356847) is N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide is CC(=O)NCOCCN(CC(N)=O)C(=O)CC(F)(F)F.
What is the InChIKey of N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide?
The InChIKey is JITJGGVVYQBSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3O4/c1-7(17)15-6-20-3-2-16(5-8(14)18)9(19)4-10(11,12)13/h2-6H2,1H3,(H2,14,18)(H,15,17).
What are the key properties of N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide?
N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide has a molecular weight of 299.25 g/mol, XLogP of -0.64, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 177356847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).