C11H18F3N3 — CID 177356988
(1Z,5E)-4-ethylimino-7,7,7-trifluoro-1-N,6-dimethylhepta-1,5-diene-1,2-diamine (PubChem CID 177356988) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is (1Z,5E)-4-ethylimino-7,7,7-trifluoro-1-N,6-dimethylhepta-1,5-diene-1,2-diamine.
| Compound Name | (1Z,5E)-4-ethylimino-7,7,7-trifluoro-1-N,6-dimethylhepta-1,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 177356988 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (1Z,5E)-4-ethylimino-7,7,7-trifluoro-1-N,6-dimethylhepta-1,5-diene-1,2-diamine |
| SMILES | CC/N=C(\C=C(/C)C(F)(F)F)C/C(N)=C/NC |
| InChI | InChI=1S/C11H18F3N3/c1-4-17-10(6-9(15)7-16-3)5-8(2)11(12,13)14/h5,7,16H,4,6,15H2,1-3H3/b8-5+,9-7-,17-10+ |
| InChIKey | LGEAZBCODDXCNQ-VGVSQKDASA-N |
| XLogP | 2.37 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|