About 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one
2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one (PubChem CID 177357041) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one |
| PubChem CID | 177357041 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one |
| SMILES | CC1CCOC(C)C1.COCCN1CCNC1=O |
| InChI | InChI=1S/C7H14O.C6H12N2O2/c1-6-3-4-8-7(2)5-6;1-10-5-4-8-3-2-7-6(8)9/h6-7H,3-5H2,1-2H3;2-5H2,1H3,(H,7,9) |
| InChIKey | ZGZIALLMCGFLRV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one?
The IUPAC name of 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one (CID 177357041) is 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one.
What is the SMILES notation for 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one?
The canonical SMILES for 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one is CC1CCOC(C)C1.COCCN1CCNC1=O.
What is the InChIKey of 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one?
The InChIKey is ZGZIALLMCGFLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C6H12N2O2/c1-6-3-4-8-7(2)5-6;1-10-5-4-8-3-2-7-6(8)9/h6-7H,3-5H2,1-2H3;2-5H2,1H3,(H,7,9).
What are the key properties of 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one?
2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one has a molecular weight of 258.36 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyloxane;1-(2-methoxyethyl)imidazolidin-2-one is sourced from PubChem (CID 177357041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).